CAS 1184979-29-0 appears in our catalog under these names: Gimeracil-13C3, >95% (HPLC), Gimeracil-13C3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 1mg, 10mg, 50mg, 25mg, 5 mg, 1 mg.
5-chloro-4-hydroxy-(4,5,6-13C3)1H-pyridin-2-one (CAS 1184979-29-0) is a chemical compound with the molecular formula C5H4ClNO2 and a molecular weight of 148.52 g/mol. IUPAC name: 5-chloro-4-hydroxy-(4,5,6-13C3)1H-pyridin-2-one. InChIKey: ZPLQIPFOCGIIHV-VWNJCJTFSA-N.
| Molecular formula | C5H4ClNO2 |
|---|---|
| Molecular weight | 148.52 g/mol |
| IUPAC name | 5-chloro-4-hydroxy-(4,5,6-13C3)1H-pyridin-2-one |
| InChIKey | ZPLQIPFOCGIIHV-VWNJCJTFSA-N |
| SMILES | C1=[13C]([13C](=[13CH]NC1=O)Cl)O |
Computed by PubChem (NCBI)