Products 914637-76-6

CAS 914637-76-6 is the registry number for 5-Methyl-1,3-oxazole-4-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

5-methyl-1,3-oxazole-4-carbonyl chloride (CAS 914637-76-6) is a chemical compound with the molecular formula C5H4ClNO2 and a molecular weight of 145.54 g/mol. IUPAC name: 5-methyl-1,3-oxazole-4-carbonyl chloride. InChIKey: KEZILNYHDBBHBM-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4ClNO2
Molecular weight145.54 g/mol
IUPAC name5-methyl-1,3-oxazole-4-carbonyl chloride
InChIKeyKEZILNYHDBBHBM-UHFFFAOYSA-N
SMILESCC1=C(N=CO1)C(=O)Cl

Computed by PubChem (NCBI)