CAS 1184982-52-2 is the registry number for 5–Benzyl–10–hydroxy–10,11–dihydro–5H–dibenz(b,f)azepine–d3. Offered by: GLPBio. Available pack sizes: 100mg.
11-benzyl-5,6,6-trideuteriobenzo[b][1]benzazepin-5-ol (CAS 1184982-52-2) is a chemical compound with the molecular formula C21H19NO and a molecular weight of 304.4 g/mol. IUPAC name: 11-benzyl-5,6,6-trideuteriobenzo[b][1]benzazepin-5-ol. InChIKey: XCELQJUXTOVVAV-IOPCVUFMSA-N.
| Molecular formula | C21H19NO |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 11-benzyl-5,6,6-trideuteriobenzo[b][1]benzazepin-5-ol |
| InChIKey | XCELQJUXTOVVAV-IOPCVUFMSA-N |
| SMILES | [2H]C1(C2=CC=CC=C2N(C3=CC=CC=C3C1([2H])O)CC4=CC=CC=C4)[2H] |
Computed by PubChem (NCBI)