CAS 332411-18-4 appears in our catalog under these names: 4-(Di-m-tolylamino)benzaldehyde, 97%, 4-(Di-m-tolyl-amino)-benzaldehyde, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 10g, 1g.
4-(3-methyl-N-(3-methylphenyl)anilino)benzaldehyde (CAS 332411-18-4) is a chemical compound with the molecular formula C21H19NO and a molecular weight of 301.4 g/mol. IUPAC name: 4-(3-methyl-N-(3-methylphenyl)anilino)benzaldehyde. InChIKey: OLIQNHVNTIFEEX-UHFFFAOYSA-N.
| Molecular formula | C21H19NO |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 4-(3-methyl-N-(3-methylphenyl)anilino)benzaldehyde |
| InChIKey | OLIQNHVNTIFEEX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C2=CC=C(C=C2)C=O)C3=CC=CC(=C3)C |
Computed by PubChem (NCBI)