Products 1184993-97-2
CAS 1184993-97-2 is the registry number for N-(3-Mercapto-2-methylpropanoyl)glycine-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2-[[3,3,3-trideuterio-2-[dideuterio(sulfanyl)methyl]propanoyl]amino]acetic acid (CAS 1184993-97-2) is a chemical compound with the molecular formula C6H11NO3S and a molecular weight of 182.25 g/mol. IUPAC name: 2-[[3,3,3-trideuterio-2-[dideuterio(sulfanyl)methyl]propanoyl]amino]acetic acid. InChIKey: VXOCIBBWDLKODX-WNWXXORZSA-N.
| Molecular formula | C6H11NO3S |
|---|---|
| Molecular weight | 182.25 g/mol |
| IUPAC name | 2-[[3,3,3-trideuterio-2-[dideuterio(sulfanyl)methyl]propanoyl]amino]acetic acid |
| InChIKey | VXOCIBBWDLKODX-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)NCC(=O)O)C([2H])([2H])S |
Computed by PubChem (NCBI)