Products 1184998-71-7
CAS 1184998-71-7 appears in our catalog under these names: 1,3-Cyclohexanedione-1,2,3-13C3, Cyclohexane-1,3-dione-13C3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
(1,2,3-13C3)cyclohexane-1,3-dione (CAS 1184998-71-7) is a chemical compound with the molecular formula C6H8O2 and a molecular weight of 115.10 g/mol. IUPAC name: (1,2,3-13C3)cyclohexane-1,3-dione. InChIKey: HJSLFCCWAKVHIW-VMGGCIAMSA-N.
| Molecular formula | C6H8O2 |
|---|---|
| Molecular weight | 115.10 g/mol |
| IUPAC name | (1,2,3-13C3)cyclohexane-1,3-dione |
| InChIKey | HJSLFCCWAKVHIW-VMGGCIAMSA-N |
| SMILES | C1C[13C](=O)[13CH2][13C](=O)C1 |
Computed by PubChem (NCBI)