Products 1246820-51-8
CAS 1246820-51-8 appears in our catalog under these names: 1,3-Cyclohexanedione-13C6, Cyclohexane-1,3-dione-13C6. Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 25 mg, 2.5 mg.
(1,2,3,4,5,6-13C6)cyclohexane-1,3-dione (CAS 1246820-51-8) is a chemical compound with the molecular formula C6H8O2 and a molecular weight of 118.083 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexane-1,3-dione. InChIKey: HJSLFCCWAKVHIW-IDEBNGHGSA-N.
| Molecular formula | C6H8O2 |
|---|---|
| Molecular weight | 118.083 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexane-1,3-dione |
| InChIKey | HJSLFCCWAKVHIW-IDEBNGHGSA-N |
| SMILES | [13CH2]1[13CH2][13C](=O)[13CH2][13C](=O)[13CH2]1 |
Computed by PubChem (NCBI)