CAS 1185022-85-8 appears in our catalog under these names: Bromazepam-d4, Bromazepam-D4, 0.1mg/ml in Methanol, Bromazepam-D4, 1mg/ml in Methanol. Offered by: TRC, Lipomed. Available pack sizes: 10mg, 1mg, 50mg, 100mg, 1ml.
7-bromo-5-(3,4,5,6-tetradeuterio-2-pyridinyl)-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 1185022-85-8) is a chemical compound with the molecular formula C14H10BrN3O and a molecular weight of 320.18 g/mol. IUPAC name: 7-bromo-5-(3,4,5,6-tetradeuterio-2-pyridinyl)-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: VMIYHDSEFNYJSL-VTBMLFEUSA-N.
| Molecular formula | C14H10BrN3O |
|---|---|
| Molecular weight | 320.18 g/mol |
| IUPAC name | 7-bromo-5-(3,4,5,6-tetradeuterio-2-pyridinyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | VMIYHDSEFNYJSL-VTBMLFEUSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])C2=NCC(=O)NC3=C2C=C(C=C3)Br)[2H])[2H] |
Computed by PubChem (NCBI)