CAS 937654-87-0 is the registry number for 3-[3-(4-Bromophenyl)-1,2,4-oxadiazol-5-yl]aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]aniline (CAS 937654-87-0) is a chemical compound with the molecular formula C14H10BrN3O and a molecular weight of 316.15 g/mol. IUPAC name: 3-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]aniline. InChIKey: DAYBLGHBUFHVPT-UHFFFAOYSA-N.
| Molecular formula | C14H10BrN3O |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | 3-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]aniline |
| InChIKey | DAYBLGHBUFHVPT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NC(=NO2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)