CAS 1185040-16-7 appears in our catalog under these names: 2-(4-Fluorophenyl) thiomorpholine hydrochloride, 95%, 2-(4-Fluorophenyl)thiomorpholine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
2-(4-fluorophenyl)thiomorpholine;hydrochloride (CAS 1185040-16-7) is a chemical compound with the molecular formula C10H13ClFNS and a molecular weight of 233.73 g/mol. IUPAC name: 2-(4-fluorophenyl)thiomorpholine;hydrochloride. InChIKey: SOTVYISDULFFRP-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNS |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | 2-(4-fluorophenyl)thiomorpholine;hydrochloride |
| InChIKey | SOTVYISDULFFRP-UHFFFAOYSA-N |
| SMILES | C1CSC(CN1)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)