CAS 1353995-35-3 appears in our catalog under these names: (S)–3–((4–Fluorophenyl)thio)pyrrolidine hydrochloride, (S)-3-((4-Fluorophenyl)thio)pyrrolidine hydrochloride, 97%, (S)-3-(4-Fluoro-phenylsulfanyl)-pyrrolidine hydrochloride, 97%, (S)-3-(4-Fluoro-phenylsulfanyl)-pyrrolidine hydrochloride, 97%, 97%. Offered by: GLPBio, AmBeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 5g, 500mg, 1g.
(3S)-3-(4-fluorophenyl)sulfanylpyrrolidine;hydrochloride (CAS 1353995-35-3) is a chemical compound with the molecular formula C10H13ClFNS and a molecular weight of 233.73 g/mol. IUPAC name: (3S)-3-(4-fluorophenyl)sulfanylpyrrolidine;hydrochloride. InChIKey: BXLVMMWEVIZWRO-PPHPATTJSA-N.
| Molecular formula | C10H13ClFNS |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | (3S)-3-(4-fluorophenyl)sulfanylpyrrolidine;hydrochloride |
| InChIKey | BXLVMMWEVIZWRO-PPHPATTJSA-N |
| SMILES | C1CNC[C@H]1SC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)