CAS 1185049-09-5 appears in our catalog under these names: Flumequine–13C3, Flumequine-13C3, Flumequine-13C3, >95% (HPLC), Flumequine 13C3, Flumequine 13C3 100 µg/mL in Acetonitrile. Offered by: GLPBio, Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol. Available pack sizes: 5mg, on request, 10mg, 1mg, 1ml, 1x10mg, 1 mg.
7-fluoro-12-methyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid (CAS 1185049-09-5) is a chemical compound with the molecular formula C14H12FNO3 and a molecular weight of 264.23 g/mol. IUPAC name: 7-fluoro-12-methyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid. InChIKey: DPSPPJIUMHPXMA-AIGZGMKWSA-N.
| Molecular formula | C14H12FNO3 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | 7-fluoro-12-methyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid |
| InChIKey | DPSPPJIUMHPXMA-AIGZGMKWSA-N |
| SMILES | CC1CCC2=C3N1C=[13C]([13C](=O)C3=CC(=C2)F)[13C](=O)O |
Computed by PubChem (NCBI)