CAS 1195781-24-8 is the registry number for benzyl N-(2-fluoro-4-hydroxyphenyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Benzyl N-(2-fluoro-4-hydroxyphenyl)carbamate (CAS 1195781-24-8) is a chemical compound with the molecular formula C14H12FNO3 and a molecular weight of 261.25 g/mol. IUPAC name: benzyl N-(2-fluoro-4-hydroxyphenyl)carbamate. InChIKey: QCKYXWPJVZIQHP-UHFFFAOYSA-N.
| Molecular formula | C14H12FNO3 |
|---|---|
| Molecular weight | 261.25 g/mol |
| IUPAC name | benzyl N-(2-fluoro-4-hydroxyphenyl)carbamate |
| InChIKey | QCKYXWPJVZIQHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=C(C=C(C=C2)O)F |
Computed by PubChem (NCBI)