CAS 1185071-29-7 appears in our catalog under these names: rac-Levomepromazine-d3, 3-(2-Methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine-D3, (±)-Levomepromazine-d3. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 1mg, 5mg.
N,N,2-trimethyl-3-[2-(trideuteriomethoxy)phenothiazin-10-yl]propan-1-amine (CAS 1185071-29-7) is a chemical compound with the molecular formula C19H24N2OS and a molecular weight of 331.5 g/mol. IUPAC name: N,N,2-trimethyl-3-[2-(trideuteriomethoxy)phenothiazin-10-yl]propan-1-amine. InChIKey: VRQVVMDWGGWHTJ-GKOSEXJESA-N.
| Molecular formula | C19H24N2OS |
|---|---|
| Molecular weight | 331.5 g/mol |
| IUPAC name | N,N,2-trimethyl-3-[2-(trideuteriomethoxy)phenothiazin-10-yl]propan-1-amine |
| InChIKey | VRQVVMDWGGWHTJ-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)SC3=CC=CC=C3N2CC(C)CN(C)C |
Computed by PubChem (NCBI)