Products 1346603-20-0
CAS 1346603-20-0 appears in our catalog under these names: 2-(1-Hydroxyethyl) Promazine-d4, >95% (HPLC), 2-(1-Hydroxyethyl) Promazine-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
1,2,2,2-tetradeuterio-1-[10-[3-(dimethylamino)propyl]phenothiazin-2-yl]ethanol (CAS 1346603-20-0) is a chemical compound with the molecular formula C19H24N2OS and a molecular weight of 332.5 g/mol. IUPAC name: 1,2,2,2-tetradeuterio-1-[10-[3-(dimethylamino)propyl]phenothiazin-2-yl]ethanol. InChIKey: ZIJWCRNUEBJMSQ-CZEVESCESA-N.
| Molecular formula | C19H24N2OS |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | 1,2,2,2-tetradeuterio-1-[10-[3-(dimethylamino)propyl]phenothiazin-2-yl]ethanol |
| InChIKey | ZIJWCRNUEBJMSQ-CZEVESCESA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN(C)C)O |
Computed by PubChem (NCBI)