CAS 1185084-01-8 is the registry number for 5-Hydroxy Propranolol-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
5-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-ol (CAS 1185084-01-8) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 280.37 g/mol. IUPAC name: 5-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-ol. InChIKey: WMYPGILKDMWISO-LQBDHZFKSA-N.
| Molecular formula | C16H21NO3 |
|---|---|
| Molecular weight | 280.37 g/mol |
| IUPAC name | 5-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-ol |
| InChIKey | WMYPGILKDMWISO-LQBDHZFKSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=CC2=C1C=CC=C2O)O)NC(C)C |
Computed by PubChem (NCBI)