Products 1185084-49-4
CAS 1185084-49-4 appears in our catalog under these names: Rabeprazole-d3 Sulfide, Rabeprazole sulfide-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, 25 mg, 1 mg, 10 mg.
2-[[3-methyl-4-[3-(trideuteriomethoxy)propoxy]-2-pyridinyl]methylsulfanyl]-1H-benzimidazole (CAS 1185084-49-4) is a chemical compound with the molecular formula C18H21N3O2S and a molecular weight of 346.5 g/mol. IUPAC name: 2-[[3-methyl-4-[3-(trideuteriomethoxy)propoxy]-2-pyridinyl]methylsulfanyl]-1H-benzimidazole. InChIKey: BSXAHDOWMOSVAP-BMSJAHLVSA-N.
| Molecular formula | C18H21N3O2S |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | 2-[[3-methyl-4-[3-(trideuteriomethoxy)propoxy]-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
| InChIKey | BSXAHDOWMOSVAP-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OCCCOC1=C(C(=NC=C1)CSC2=NC3=CC=CC=C3N2)C |
Computed by PubChem (NCBI)
Synonyms:
Rabeprazole-d3 Sulfide