Products 1479164-99-2
CAS 1479164-99-2 is the registry number for N-tert-Butyl-1-tosyl-1H-benzo(d)imidazol-2-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
N-tert-butyl-1-(4-methylphenyl)sulfonylbenzimidazol-2-amine (CAS 1479164-99-2) is a chemical compound with the molecular formula C18H21N3O2S and a molecular weight of 343.4 g/mol. IUPAC name: N-tert-butyl-1-(4-methylphenyl)sulfonylbenzimidazol-2-amine. InChIKey: WQUXIQUKCJOCEX-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O2S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | N-tert-butyl-1-(4-methylphenyl)sulfonylbenzimidazol-2-amine |
| InChIKey | WQUXIQUKCJOCEX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C3=CC=CC=C3N=C2NC(C)(C)C |
Computed by PubChem (NCBI)