Products 1185097-33-9
CAS 1185097-33-9 appears in our catalog under these names: rac-Cinacalcet-d3 HCl, rac Cinacalcet-d3 Hydrochloride, (Rac)-Cinacalcet-d3 (hydrochloride). Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 10 mg, 1 mg.
N-(2,2,2-trideuterio-1-naphthalen-1-ylethyl)-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (CAS 1185097-33-9) is a chemical compound with the molecular formula C22H23ClF3N and a molecular weight of 396.9 g/mol. IUPAC name: N-(2,2,2-trideuterio-1-naphthalen-1-ylethyl)-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride. InChIKey: QANQWUQOEJZMLL-NIIDSAIPSA-N.
| Molecular formula | C22H23ClF3N |
|---|---|
| Molecular weight | 396.9 g/mol |
| IUPAC name | N-(2,2,2-trideuterio-1-naphthalen-1-ylethyl)-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| InChIKey | QANQWUQOEJZMLL-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=CC2=CC=CC=C21)NCCCC3=CC(=CC=C3)C(F)(F)F.Cl |
Computed by PubChem (NCBI)