CAS 1217809-88-5 appears in our catalog under these names: Ent-Cinacalcet HCl, ent-Cinacalcet Hydrochloride, (S)-Cinacalcet Hydrochloride, N-(1-(S)-(-)-(1-Naphthyl)ethyl)-3-(3-(trifluoromethyl)phenyl)-1-aminopropane hydrochloride, (S)-Cinacalcet (hydrochloride), 99.84%. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 5mg, 50mg, 5 g, 500 mg, 100 mg.
N-[(1S)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (CAS 1217809-88-5) is a chemical compound with the molecular formula C22H23ClF3N and a molecular weight of 393.9 g/mol. IUPAC name: N-[(1S)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride. InChIKey: QANQWUQOEJZMLL-NTISSMGPSA-N.
| Molecular formula | C22H23ClF3N |
|---|---|
| Molecular weight | 393.9 g/mol |
| IUPAC name | N-[(1S)-1-naphthalen-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| InChIKey | QANQWUQOEJZMLL-NTISSMGPSA-N |
| SMILES | C[C@@H](C1=CC=CC2=CC=CC=C21)NCCCC3=CC(=CC=C3)C(F)(F)F.Cl |
Computed by PubChem (NCBI)