Products 1185177-97-2
CAS 1185177-97-2 appears in our catalog under these names: Ractopamine-d6 (Mixture of Diastereomers), Ractopamine-d6. Offered by: Chemat Brand, TargetMol, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 5 mg, 1 mg.
4-[2,2,3,4,4,4-hexadeuterio-3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol (CAS 1185177-97-2) is a chemical compound with the molecular formula C18H23NO3 and a molecular weight of 307.4 g/mol. IUPAC name: 4-[2,2,3,4,4,4-hexadeuterio-3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol. InChIKey: YJQZYXCXBBCEAQ-NZXJLHLRSA-N.
| Molecular formula | C18H23NO3 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 4-[2,2,3,4,4,4-hexadeuterio-3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol |
| InChIKey | YJQZYXCXBBCEAQ-NZXJLHLRSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])CC1=CC=C(C=C1)O)NCC(C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)