Products 1219908-63-0
CAS 1219908-63-0 is the registry number for Ractopamine-d3 (Mixture of Diastereomers). Offered by: Chemat Brand. Available pack sizes: on request.
4-[3-[[1,1,2-trideuterio-2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol (CAS 1219908-63-0) is a chemical compound with the molecular formula C18H23NO3 and a molecular weight of 304.4 g/mol. IUPAC name: 4-[3-[[1,1,2-trideuterio-2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol. InChIKey: YJQZYXCXBBCEAQ-RAPJRIDRSA-N.
| Molecular formula | C18H23NO3 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 4-[3-[[1,1,2-trideuterio-2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]phenol |
| InChIKey | YJQZYXCXBBCEAQ-RAPJRIDRSA-N |
| SMILES | [2H]C([2H])(C([2H])(C1=CC=C(C=C1)O)O)NC(C)CCC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)