CAS 1185234-99-4 appears in our catalog under these names: Dantrolene-13C3, Dantrolene-13C3, >95% (HPLC), Dantrolene–13C3, Dantrolene-13C3, 99.0%, 13C3-Dantrolene. Offered by: Hubei YoungXin, TRC, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 5 mg.
1-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-(2,4,5-13C3)1,3-diazolidine-2,4-dione (CAS 1185234-99-4) is a chemical compound with the molecular formula C14H10N4O5 and a molecular weight of 317.23 g/mol. IUPAC name: 1-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-(2,4,5-13C3)1,3-diazolidine-2,4-dione. InChIKey: OZOMQRBLCMDCEG-VFVCCWAMSA-N.
| Molecular formula | C14H10N4O5 |
|---|---|
| Molecular weight | 317.23 g/mol |
| IUPAC name | 1-[(E)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-(2,4,5-13C3)1,3-diazolidine-2,4-dione |
| InChIKey | OZOMQRBLCMDCEG-VFVCCWAMSA-N |
| SMILES | [13CH2]1[13C](=O)N[13C](=O)N1/N=C/C2=CC=C(O2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)