Products 161536-59-0
CAS 161536-59-0 is the registry number for 4-Azidobenzyl (4-nitrophenyl) carbonate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-azidophenyl)methyl (4-nitrophenyl) carbonate (CAS 161536-59-0) is a chemical compound with the molecular formula C14H10N4O5 and a molecular weight of 314.25 g/mol. IUPAC name: (4-azidophenyl)methyl (4-nitrophenyl) carbonate. InChIKey: YWNRQIIAFXIOSH-UHFFFAOYSA-N.
| Molecular formula | C14H10N4O5 |
|---|---|
| Molecular weight | 314.25 g/mol |
| IUPAC name | (4-azidophenyl)methyl (4-nitrophenyl) carbonate |
| InChIKey | YWNRQIIAFXIOSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-])N=[N+]=[N-] |
Computed by PubChem (NCBI)