CAS 1185241-40-0 appears in our catalog under these names: N-(2-Amino-ethyl)-2-(benzyl-phenyl-amino)-acetamide maleate, 95%, N-(2-Aminoethyl)-2-(benzyl(phenyl)amino)acetamide maleate, 97%, N-(2-Aminoethyl)-2-(benzyl(phenyl)amino)acetamide maleate, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
N-(2-aminoethyl)-2-(N-benzylanilino)acetamide;(Z)-but-2-enedioic acid (CAS 1185241-40-0) is a chemical compound with the molecular formula C21H25N3O5 and a molecular weight of 399.4 g/mol. IUPAC name: N-(2-aminoethyl)-2-(N-benzylanilino)acetamide;(Z)-but-2-enedioic acid. InChIKey: KLWQMCCSTDJOLF-BTJKTKAUSA-N.
| Molecular formula | C21H25N3O5 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | N-(2-aminoethyl)-2-(N-benzylanilino)acetamide;(Z)-but-2-enedioic acid |
| InChIKey | KLWQMCCSTDJOLF-BTJKTKAUSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC(=O)NCCN)C2=CC=CC=C2.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)