CAS 1352916-15-4 appears in our catalog under these names: Diisopropyl 4-(benzo[c][1,2,5]oxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate, 95%, Isradipine EP Impurity B, Isradipine Impurity 2(Isradipine EP Impurity B). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Dipropan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 1352916-15-4) is a chemical compound with the molecular formula C21H25N3O5 and a molecular weight of 399.4 g/mol. IUPAC name: dipropan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: SKQSFQRPVQIHLU-UHFFFAOYSA-N.
| Molecular formula | C21H25N3O5 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | dipropan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | SKQSFQRPVQIHLU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC(C)C)C2=CC=CC3=NON=C32)C(=O)OC(C)C |
Computed by PubChem (NCBI)