CAS 1185242-69-6 appears in our catalog under these names: Temozolomide Metabolite-MTIC-d3, MTIC-d3, >95% (HPLC), MTIC-d3. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
4-[2-(trideuteriomethylimino)hydrazinyl]-1H-imidazole-5-carboxamide (CAS 1185242-69-6) is a chemical compound with the molecular formula C5H8N6O and a molecular weight of 171.18 g/mol. IUPAC name: 4-[2-(trideuteriomethylimino)hydrazinyl]-1H-imidazole-5-carboxamide. InChIKey: MVBPAIHFZZKRGD-FIBGUPNXSA-N.
| Molecular formula | C5H8N6O |
|---|---|
| Molecular weight | 171.18 g/mol |
| IUPAC name | 4-[2-(trideuteriomethylimino)hydrazinyl]-1H-imidazole-5-carboxamide |
| InChIKey | MVBPAIHFZZKRGD-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N=NNC1=C(NC=N1)C(=O)N |
Computed by PubChem (NCBI)