CAS 402846-48-4 appears in our catalog under these names: 2,6-Diaminopurine hydrate, 98%, 9H-Purine-2,6-diamine hydrate, 98%, 2,6–Diaminopurine Monohydrate, 2,6-Diaminopurine Monohydrate, >97.0%(HPLC)(T), 2,6-DIAMINOPURINE HYDRATE. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 100g, 1g, 500g, 25g, 5g, 250mg, 100mg.
7H-purine-2,6-diamine;hydrate (CAS 402846-48-4) is a chemical compound with the molecular formula C5H8N6O and a molecular weight of 168.16 g/mol. IUPAC name: 7H-purine-2,6-diamine;hydrate. InChIKey: UKADKJJNEZZNGH-UHFFFAOYSA-N.
| Molecular formula | C5H8N6O |
|---|---|
| Molecular weight | 168.16 g/mol |
| IUPAC name | 7H-purine-2,6-diamine;hydrate |
| InChIKey | UKADKJJNEZZNGH-UHFFFAOYSA-N |
| SMILES | C1=NC2=NC(=NC(=C2N1)N)N.O |
Computed by PubChem (NCBI)