Products 1185242-90-3
CAS 1185242-90-3 appears in our catalog under these names: Mycophenolic Acid-D3, Mycophenolic acid d3, Mycophenolic Acid-d3, >95% (HPLC), Mycophenolic acid-d3, 99.59%. Offered by: Chemat Brand, TRC, TargetMol, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 0,5mg, 2mg, 1 mg.
(E)-6-[4-hydroxy-7-methyl-3-oxo-6-(trideuteriomethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid (CAS 1185242-90-3) is a chemical compound with the molecular formula C17H20O6 and a molecular weight of 323.35 g/mol. IUPAC name: (E)-6-[4-hydroxy-7-methyl-3-oxo-6-(trideuteriomethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid. InChIKey: HPNSFSBZBAHARI-HZIIEIAOSA-N.
| Molecular formula | C17H20O6 |
|---|---|
| Molecular weight | 323.35 g/mol |
| IUPAC name | (E)-6-[4-hydroxy-7-methyl-3-oxo-6-(trideuteriomethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
| InChIKey | HPNSFSBZBAHARI-HZIIEIAOSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C(=C2C(=C1C)COC2=O)O)C/C=C(\C)/CCC(=O)O |
Computed by PubChem (NCBI)