Products 2033106-92-0
CAS 2033106-92-0 is the registry number for Mycophenolic Acid-d3. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-6-[4-hydroxy-7-methyl-3-oxo-6-(trideuteriomethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid (CAS 2033106-92-0) is a chemical compound with the molecular formula C17H20O6 and a molecular weight of 323.35 g/mol. IUPAC name: (E)-6-[4-hydroxy-7-methyl-3-oxo-6-(trideuteriomethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid. InChIKey: HPNSFSBZBAHARI-HZIIEIAOSA-N.
| Molecular formula | C17H20O6 |
|---|---|
| Molecular weight | 323.35 g/mol |
| IUPAC name | (E)-6-[4-hydroxy-7-methyl-3-oxo-6-(trideuteriomethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
| InChIKey | HPNSFSBZBAHARI-HZIIEIAOSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C(=C2C(=C1C)COC2=O)O)C/C=C(\C)/CCC(=O)O |
Computed by PubChem (NCBI)