CAS 1185246-59-6 appears in our catalog under these names: Clovoxamine-D3 Fumarate, Clovoxamine-d3. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg.
2-[(E)-[1-(4-chlorophenyl)-5-(trideuteriomethoxy)pentylidene]amino]oxyethanamine (CAS 1185246-59-6) is a chemical compound with the molecular formula C14H21ClN2O2 and a molecular weight of 287.80 g/mol. IUPAC name: 2-[(E)-[1-(4-chlorophenyl)-5-(trideuteriomethoxy)pentylidene]amino]oxyethanamine. InChIKey: XXPVSQRPGBUFKM-AVARJMBTSA-N.
| Molecular formula | C14H21ClN2O2 |
|---|---|
| Molecular weight | 287.80 g/mol |
| IUPAC name | 2-[(E)-[1-(4-chlorophenyl)-5-(trideuteriomethoxy)pentylidene]amino]oxyethanamine |
| InChIKey | XXPVSQRPGBUFKM-AVARJMBTSA-N |
| SMILES | [2H]C([2H])([2H])OCCCC/C(=N\OCCN)/C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)