CAS 1221726-16-4 appears in our catalog under these names: 4-(4-(Propan-2-yl)piperazin-1-yl)benzoic acid hydrochloride, 4-[4-(Propan-2-yl)piperazin-1-yl]benzoic acid hydrochloride, 95%, 4-(4-(Propan-2-yl)piperazin-1-yl)benzoic acid hydrochloride, 98%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 250mg, 100mg, 10g.
4-(4-propan-2-ylpiperazin-1-yl)benzoic acid;hydrochloride (CAS 1221726-16-4) is a chemical compound with the molecular formula C14H21ClN2O2 and a molecular weight of 284.78 g/mol. IUPAC name: 4-(4-propan-2-ylpiperazin-1-yl)benzoic acid;hydrochloride. InChIKey: IWUKEARREIYNCJ-UHFFFAOYSA-N.
| Molecular formula | C14H21ClN2O2 |
|---|---|
| Molecular weight | 284.78 g/mol |
| IUPAC name | 4-(4-propan-2-ylpiperazin-1-yl)benzoic acid;hydrochloride |
| InChIKey | IWUKEARREIYNCJ-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCN(CC1)C2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)