Products 1392217-44-5
CAS 1392217-44-5 appears in our catalog under these names: Eicosapentaenoic Acid Ethyl-d5 Ester, Eicosapentaenoic acid ethyl ester-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 5mg, 1mg.
1,1,2,2,2-pentadeuterioethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate (CAS 1392217-44-5) is a chemical compound with the molecular formula C22H34O2 and a molecular weight of 335.5 g/mol. IUPAC name: 1,1,2,2,2-pentadeuterioethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate. InChIKey: SSQPWTVBQMWLSZ-GBJCQEPPSA-N.
| Molecular formula | C22H34O2 |
|---|---|
| Molecular weight | 335.5 g/mol |
| IUPAC name | 1,1,2,2,2-pentadeuterioethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| InChIKey | SSQPWTVBQMWLSZ-GBJCQEPPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC |
Computed by PubChem (NCBI)