CAS 1185282-16-9 appears in our catalog under these names: AB-FUBINACA 2-Fluorobenzyl Isomer, AB–FUBINACA 2–fluorobenzyl isomer. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 1mg, 10mg, 5mg.
N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(2-fluorophenyl)methyl]indazole-3-carboxamide (CAS 1185282-16-9) is a chemical compound with the molecular formula C20H21FN4O2 and a molecular weight of 368.4 g/mol. IUPAC name: N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(2-fluorophenyl)methyl]indazole-3-carboxamide. InChIKey: AJGUHANHCUPXSK-KRWDZBQOSA-N.
| Molecular formula | C20H21FN4O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(2-fluorophenyl)methyl]indazole-3-carboxamide |
| InChIKey | AJGUHANHCUPXSK-KRWDZBQOSA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC(=O)C1=NN(C2=CC=CC=C21)CC3=CC=CC=C3F |
Computed by PubChem (NCBI)