CAS 1629062-56-1 is the registry number for AB FUBINACA. Offered by: TRC. Available pack sizes: 25mg.
N-(1-amino-3-methyl-1-oxobutan-2-yl)-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide (CAS 1629062-56-1) is a chemical compound with the molecular formula C20H21FN4O2 and a molecular weight of 368.4 g/mol. IUPAC name: N-(1-amino-3-methyl-1-oxobutan-2-yl)-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide. InChIKey: AKOOIMKXADOPDA-UHFFFAOYSA-N.
| Molecular formula | C20H21FN4O2 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | N-(1-amino-3-methyl-1-oxobutan-2-yl)-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide |
| InChIKey | AKOOIMKXADOPDA-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)N)NC(=O)C1=NN(C2=CC=CC=C21)CC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)