Products 1185297-29-3

CAS 1185297-29-3 is the registry number for 4-(4-Chloro-2-fluorophenoxy)piperidine hydrochloride, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

4-(4-chloro-2-fluorophenoxy)piperidine;hydrochloride (CAS 1185297-29-3) is a chemical compound with the molecular formula C11H14Cl2FNO and a molecular weight of 266.14 g/mol. IUPAC name: 4-(4-chloro-2-fluorophenoxy)piperidine;hydrochloride. InChIKey: WQNCGOSHYCTGIL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14Cl2FNO
Molecular weight266.14 g/mol
IUPAC name4-(4-chloro-2-fluorophenoxy)piperidine;hydrochloride
InChIKeyWQNCGOSHYCTGIL-UHFFFAOYSA-N
SMILESC1CNCCC1OC2=C(C=C(C=C2)Cl)F.Cl

Computed by PubChem (NCBI)