CAS 1354488-37-1 is the registry number for Rac-[(3s,4r)-4-(4-chloro-2-fluorophenyl)-3-pyrrolidinyl]methanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[(3S,4R)-4-(4-chloro-2-fluorophenyl)pyrrolidin-3-yl]methanol;hydrochloride (CAS 1354488-37-1) is a chemical compound with the molecular formula C11H14Cl2FNO and a molecular weight of 266.14 g/mol. IUPAC name: [(3S,4R)-4-(4-chloro-2-fluorophenyl)pyrrolidin-3-yl]methanol;hydrochloride. InChIKey: JDOAESPIZHAEGR-XQRIHRDZSA-N.
| Molecular formula | C11H14Cl2FNO |
|---|---|
| Molecular weight | 266.14 g/mol |
| IUPAC name | [(3S,4R)-4-(4-chloro-2-fluorophenyl)pyrrolidin-3-yl]methanol;hydrochloride |
| InChIKey | JDOAESPIZHAEGR-XQRIHRDZSA-N |
| SMILES | C1[C@H]([C@@H](CN1)C2=C(C=C(C=C2)Cl)F)CO.Cl |
Computed by PubChem (NCBI)