CAS 1185298-52-5 is the registry number for [2-(3-Pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride (CAS 1185298-52-5) is a chemical compound with the molecular formula C8H10ClN5O and a molecular weight of 227.65 g/mol. IUPAC name: 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride. InChIKey: GZCZLIHJFNPESX-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN5O |
|---|---|
| Molecular weight | 227.65 g/mol |
| IUPAC name | 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride |
| InChIKey | GZCZLIHJFNPESX-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=NOC(=N2)CCN.Cl |
Computed by PubChem (NCBI)