CAS 2768158-24-1 is the registry number for (S)-2-Chloro-7-(1-methoxyethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-7-[(1S)-1-methoxyethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-6-amine (CAS 2768158-24-1) is a chemical compound with the molecular formula C8H10ClN5O and a molecular weight of 227.65 g/mol. IUPAC name: 2-chloro-7-[(1S)-1-methoxyethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-6-amine. InChIKey: KHFUAJSDKMEXTO-BYPYZUCNSA-N.
| Molecular formula | C8H10ClN5O |
|---|---|
| Molecular weight | 227.65 g/mol |
| IUPAC name | 2-chloro-7-[(1S)-1-methoxyethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-6-amine |
| InChIKey | KHFUAJSDKMEXTO-BYPYZUCNSA-N |
| SMILES | C[C@@H](C1=C(C=NC2=NC(=NN12)Cl)N)OC |
Computed by PubChem (NCBI)