CAS 1185300-66-6 is the registry number for [(2-Methylphenyl)(4-pyridinyl)methyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
(2-methylphenyl)-pyridin-4-ylmethanamine;dihydrochloride (CAS 1185300-66-6) is a chemical compound with the molecular formula C13H16Cl2N2 and a molecular weight of 271.18 g/mol. IUPAC name: (2-methylphenyl)-pyridin-4-ylmethanamine;dihydrochloride. InChIKey: YXGXZKIFXHVRKN-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2N2 |
|---|---|
| Molecular weight | 271.18 g/mol |
| IUPAC name | (2-methylphenyl)-pyridin-4-ylmethanamine;dihydrochloride |
| InChIKey | YXGXZKIFXHVRKN-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(C2=CC=NC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)