CAS 17272-84-3 is the registry number for N-Benzyl-1,4-benzenediamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
4-N-benzylbenzene-1,4-diamine;dihydrochloride (CAS 17272-84-3) is a chemical compound with the molecular formula C13H16Cl2N2 and a molecular weight of 271.18 g/mol. IUPAC name: 4-N-benzylbenzene-1,4-diamine;dihydrochloride. InChIKey: NDFNHMQPNTWEKI-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2N2 |
|---|---|
| Molecular weight | 271.18 g/mol |
| IUPAC name | 4-N-benzylbenzene-1,4-diamine;dihydrochloride |
| InChIKey | NDFNHMQPNTWEKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)