CAS 1185302-68-4 is the registry number for ([5-(1,3-Benzodioxol-5-yl)-1,2,4-oxadiazol-3-yl]methyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
[5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride (CAS 1185302-68-4) is a chemical compound with the molecular formula C10H10ClN3O3 and a molecular weight of 255.66 g/mol. IUPAC name: [5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride. InChIKey: WKTHWJOMKSGKSI-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3O3 |
|---|---|
| Molecular weight | 255.66 g/mol |
| IUPAC name | [5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride |
| InChIKey | WKTHWJOMKSGKSI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NC(=NO3)CN.Cl |
Computed by PubChem (NCBI)