CAS 1638603-68-5 is the registry number for (S)-Methyl 2-(6-chloro-2-oxo-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 2-[(3S)-6-chloro-2-oxo-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-yl]acetate (CAS 1638603-68-5) is a chemical compound with the molecular formula C10H10ClN3O3 and a molecular weight of 255.66 g/mol. IUPAC name: methyl 2-[(3S)-6-chloro-2-oxo-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-yl]acetate. InChIKey: VYFWYOFPIWFTKG-LURJTMIESA-N.
| Molecular formula | C10H10ClN3O3 |
|---|---|
| Molecular weight | 255.66 g/mol |
| IUPAC name | methyl 2-[(3S)-6-chloro-2-oxo-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-yl]acetate |
| InChIKey | VYFWYOFPIWFTKG-LURJTMIESA-N |
| SMILES | COC(=O)C[C@H]1C(=O)NC2=C(N1)N=C(C=C2)Cl |
Computed by PubChem (NCBI)