CAS 1185302-90-2 appears in our catalog under these names: [3-(3-Pyrazin-2-yl-1,2,4-oxadiazol-5-yl)propyl]amine hydrochloride, 95%, 3-(3-(Pyrazin-2-yl)-1,2,4-oxadiazol-5-yl)propan-1-amine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride (CAS 1185302-90-2) is a chemical compound with the molecular formula C9H12ClN5O and a molecular weight of 241.68 g/mol. IUPAC name: 3-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride. InChIKey: KSXFGKBTXXZBOK-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN5O |
|---|---|
| Molecular weight | 241.68 g/mol |
| IUPAC name | 3-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride |
| InChIKey | KSXFGKBTXXZBOK-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=NOC(=N2)CCCN.Cl |
Computed by PubChem (NCBI)