CAS 1794811-52-1 is the registry number for Moxonidine-d4. Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg, 10 mg.
4-chloro-6-methoxy-2-methyl-N-(4,4,5,5-tetradeuterio-1H-imidazol-2-yl)pyrimidin-5-amine (CAS 1794811-52-1) is a chemical compound with the molecular formula C9H12ClN5O and a molecular weight of 245.70 g/mol. IUPAC name: 4-chloro-6-methoxy-2-methyl-N-(4,4,5,5-tetradeuterio-1H-imidazol-2-yl)pyrimidin-5-amine. InChIKey: WPNJAUFVNXKLIM-KHORGVISSA-N.
| Molecular formula | C9H12ClN5O |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | 4-chloro-6-methoxy-2-methyl-N-(4,4,5,5-tetradeuterio-1H-imidazol-2-yl)pyrimidin-5-amine |
| InChIKey | WPNJAUFVNXKLIM-KHORGVISSA-N |
| SMILES | [2H]C1(C(N=C(N1)NC2=C(N=C(N=C2Cl)C)OC)([2H])[2H])[2H] |
Computed by PubChem (NCBI)