CAS 1185303-36-9 is the registry number for Pyridine-2-carboxylic acid (2-amino-phenyl)-amide dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg.
N-(2-aminophenyl)pyridine-2-carboxamide;dihydrochloride (CAS 1185303-36-9) is a chemical compound with the molecular formula C12H13Cl2N3O and a molecular weight of 286.15 g/mol. IUPAC name: N-(2-aminophenyl)pyridine-2-carboxamide;dihydrochloride. InChIKey: ZNXAYWPSECCMQE-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2N3O |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | N-(2-aminophenyl)pyridine-2-carboxamide;dihydrochloride |
| InChIKey | ZNXAYWPSECCMQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NC(=O)C2=CC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)