CAS 959800-67-0 is the registry number for (1-(2,6-Dichlorophenyl)-4-isopropyl-1h-1,2,3-triazol-5-yl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[3-(2,6-dichlorophenyl)-5-propan-2-yltriazol-4-yl]methanol (CAS 959800-67-0) is a chemical compound with the molecular formula C12H13Cl2N3O and a molecular weight of 286.15 g/mol. IUPAC name: [3-(2,6-dichlorophenyl)-5-propan-2-yltriazol-4-yl]methanol. InChIKey: IJVUIOCXNVEGKH-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2N3O |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | [3-(2,6-dichlorophenyl)-5-propan-2-yltriazol-4-yl]methanol |
| InChIKey | IJVUIOCXNVEGKH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N(N=N1)C2=C(C=CC=C2Cl)Cl)CO |
Computed by PubChem (NCBI)