Products 1185306-03-9
CAS 1185306-03-9 is the registry number for 2-Bromo-5-picoline-d3. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg, 5mg.
2-bromo-5-(trideuteriomethyl)pyridine (CAS 1185306-03-9) is a chemical compound with the molecular formula C6H6BrN and a molecular weight of 175.04 g/mol. IUPAC name: 2-bromo-5-(trideuteriomethyl)pyridine. InChIKey: YWNJQQNBJQUKME-FIBGUPNXSA-N.
| Molecular formula | C6H6BrN |
|---|---|
| Molecular weight | 175.04 g/mol |
| IUPAC name | 2-bromo-5-(trideuteriomethyl)pyridine |
| InChIKey | YWNJQQNBJQUKME-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CN=C(C=C1)Br |
Computed by PubChem (NCBI)