CAS 1374665-50-5 is the registry number for 2-Bromo-5-picoline-d6. Offered by: TRC. Available pack sizes: 100mg.
2-bromo-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine (CAS 1374665-50-5) is a chemical compound with the molecular formula C6H6BrN and a molecular weight of 178.06 g/mol. IUPAC name: 2-bromo-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine. InChIKey: YWNJQQNBJQUKME-RLTMCGQMSA-N.
| Molecular formula | C6H6BrN |
|---|---|
| Molecular weight | 178.06 g/mol |
| IUPAC name | 2-bromo-3,4,6-trideuterio-5-(trideuteriomethyl)pyridine |
| InChIKey | YWNJQQNBJQUKME-RLTMCGQMSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1C([2H])([2H])[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)