CAS 1185306-93-7 is the registry number for 4–Chloro–6–methyl–2–(iso–propyl–d7)–pyrimidine. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
4-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-methylpyrimidine (CAS 1185306-93-7) is a chemical compound with the molecular formula C8H11ClN2 and a molecular weight of 177.68 g/mol. IUPAC name: 4-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-methylpyrimidine. InChIKey: PJCDNTVCCXJUAC-TXVPSQRDSA-N.
| Molecular formula | C8H11ClN2 |
|---|---|
| Molecular weight | 177.68 g/mol |
| IUPAC name | 4-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-6-methylpyrimidine |
| InChIKey | PJCDNTVCCXJUAC-TXVPSQRDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=NC(=CC(=N1)Cl)C)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)